About 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole
1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole (PubChem CID 87460967) has the molecular formula C12H10BrN
and a molecular weight of 248.12 g/mol. Its IUPAC name is 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole.
Molecular Properties
| Compound Name | 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole |
| PubChem CID | 87460967 |
| Molecular Formula | C12H10BrN |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole |
| SMILES | Cn1cc(Br)c2c1=CC1=CC=CCC=21 |
| InChI | InChI=1S/C12H10BrN/c1-14-7-10(13)12-9-5-3-2-4-8(9)6-11(12)14/h2-4,6-7H,5H2,1H3 |
| InChIKey | XTZKKSNPTGYQNO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole?
The IUPAC name of 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole (CID 87460967) is 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole.
What is the SMILES notation for 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole?
The canonical SMILES for 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole is Cn1cc(Br)c2c1=CC1=CC=CCC=21.
What is the InChIKey of 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole?
The InChIKey is XTZKKSNPTGYQNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrN/c1-14-7-10(13)12-9-5-3-2-4-8(9)6-11(12)14/h2-4,6-7H,5H2,1H3.
What are the key properties of 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole?
1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole has a molecular weight of 248.12 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-methyl-8H-indeno[2,1-b]pyrrole is sourced from PubChem (CID 87460967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).