About 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid
2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid (PubChem CID 87461370) has the molecular formula C24H27N3O4
and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid.
Molecular Properties
| Compound Name | 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid |
| PubChem CID | 87461370 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid |
| SMILES | Cc1nn(C)c(Oc2ccccc2)c1/C=N/OCc1ccc(C(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H27N3O4/c1-16-20(22(27(5)26-16)31-18-9-7-6-8-10-18)14-25-30-15-17-11-12-19(23(28)29)21(13-17)24(2,3)4/h6-14H,15H2,1-5H3,(H,28,29)/b25-14+ |
| InChIKey | ARKCFLJBSHELGC-AFUMVMLFSA-N |
| XLogP | 5.07 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid?
The IUPAC name of 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid (CID 87461370) is 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid.
What is the SMILES notation for 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid?
The canonical SMILES for 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid is Cc1nn(C)c(Oc2ccccc2)c1/C=N/OCc1ccc(C(=O)O)c(C(C)(C)C)c1.
What is the InChIKey of 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid?
The InChIKey is ARKCFLJBSHELGC-AFUMVMLFSA-N. The full InChI is InChI=1S/C24H27N3O4/c1-16-20(22(27(5)26-16)31-18-9-7-6-8-10-18)14-25-30-15-17-11-12-19(23(28)29)21(13-17)24(2,3)4/h6-14H,15H2,1-5H3,(H,28,29)/b25-14+.
What are the key properties of 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid?
2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid has a molecular weight of 421.50 g/mol, XLogP of 5.07, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid is sourced from PubChem (CID 87461370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).