C39H56O3P2 — CID 87461679
bis(1-adamantyl)-[[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane (PubChem CID 87461679) has the molecular formula C39H56O3P2 and a molecular weight of 634.82 g/mol. Its IUPAC name is bis(1-adamantyl)-[[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane.
| Compound Name | bis(1-adamantyl)-[[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane |
|---|---|
| PubChem CID | 87461679 |
| Molecular Formula | C39H56O3P2 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.37 |
| IUPAC Name | bis(1-adamantyl)-[[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane |
| SMILES | CC12CC3(C)OC(C)(CC(C)(O1)C3(CP)c1ccccc1CP(C13CC4CC(CC(C4)C1)C3)C13CC4CC(CC(C4)C1)C3)O2 |
| InChI | InChI=1S/C39H56O3P2/c1-33-22-35(3)41-34(2,23-36(4,40-33)42-35)39(33,24-43)32-8-6-5-7-31(32)21-44(37-15-25-9-26(16-37)11-27(10-25)17-37)38-18-28-12-29(19-38)14-30(13-28)20-38/h5-8,25-30H,9-24,43H2,1-4H3 |
| InChIKey | VTXGRRXOFASNDK-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|