About 6-(1-hydroxypropyl)benzene-1,2,4-triol
6-(1-hydroxypropyl)benzene-1,2,4-triol (PubChem CID 87461944) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 6-(1-hydroxypropyl)benzene-1,2,4-triol.
Molecular Properties
| Compound Name | 6-(1-hydroxypropyl)benzene-1,2,4-triol |
| PubChem CID | 87461944 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 6-(1-hydroxypropyl)benzene-1,2,4-triol |
| SMILES | CCC(O)c1cc(O)cc(O)c1O |
| InChI | InChI=1S/C9H12O4/c1-2-7(11)6-3-5(10)4-8(12)9(6)13/h3-4,7,10-13H,2H2,1H3 |
| InChIKey | ABSNSTGUBFGHDI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-hydroxypropyl)benzene-1,2,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-hydroxypropyl)benzene-1,2,4-triol?
The IUPAC name of 6-(1-hydroxypropyl)benzene-1,2,4-triol (CID 87461944) is 6-(1-hydroxypropyl)benzene-1,2,4-triol.
What is the SMILES notation for 6-(1-hydroxypropyl)benzene-1,2,4-triol?
The canonical SMILES for 6-(1-hydroxypropyl)benzene-1,2,4-triol is CCC(O)c1cc(O)cc(O)c1O.
What is the InChIKey of 6-(1-hydroxypropyl)benzene-1,2,4-triol?
The InChIKey is ABSNSTGUBFGHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-2-7(11)6-3-5(10)4-8(12)9(6)13/h3-4,7,10-13H,2H2,1H3.
What are the key properties of 6-(1-hydroxypropyl)benzene-1,2,4-triol?
6-(1-hydroxypropyl)benzene-1,2,4-triol has a molecular weight of 184.19 g/mol, XLogP of 1.25, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-hydroxypropyl)benzene-1,2,4-triol is sourced from PubChem (CID 87461944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).