About zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide
zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide (PubChem CID 87462018) has the molecular formula C20H35O2PS3Zn
and a molecular weight of 500.06 g/mol. Its IUPAC name is zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide.
Molecular Properties
| Compound Name | zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide |
| PubChem CID | 87462018 |
| Molecular Formula | C20H35O2PS3Zn |
| Molecular Weight | 500.06 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide |
| SMILES | CCCCCCCOP(=S)(OCCCCCCC)Sc1ccccc1.[S-2].[Zn+2] |
| InChI | InChI=1S/C20H35O2PS2.S.Zn/c1-3-5-7-9-14-18-21-23(24,22-19-15-10-8-6-4-2)25-20-16-12-11-13-17-20;;/h11-13,16-17H,3-10,14-15,18-19H2,1-2H3;;/q;-2;+2 |
| InChIKey | JGYJBZBUCRADJQ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.06 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide?
The IUPAC name of zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide (CID 87462018) is zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide.
What is the SMILES notation for zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide?
The canonical SMILES for zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide is CCCCCCCOP(=S)(OCCCCCCC)Sc1ccccc1.[S-2].[Zn+2].
What is the InChIKey of zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide?
The InChIKey is JGYJBZBUCRADJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35O2PS2.S.Zn/c1-3-5-7-9-14-18-21-23(24,22-19-15-10-8-6-4-2)25-20-16-12-11-13-17-20;;/h11-13,16-17H,3-10,14-15,18-19H2,1-2H3;;/q;-2;+2.
What are the key properties of zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide?
zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide has a molecular weight of 500.06 g/mol, XLogP of 7.97, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;diheptoxy-phenylsulfanyl-sulfanylidene-λ5-phosphane;sulfide is sourced from PubChem (CID 87462018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).