C7H11N2O5+ — CID 87462169
1,3-dimethoxy-1-methyl-1,3-diazinan-1-ium-2,4,6-trione (PubChem CID 87462169) has the molecular formula C7H11N2O5+ and a molecular weight of 203.17 g/mol. Its IUPAC name is 1,3-dimethoxy-1-methyl-1,3-diazinan-1-ium-2,4,6-trione.
| Compound Name | 1,3-dimethoxy-1-methyl-1,3-diazinan-1-ium-2,4,6-trione |
|---|---|
| PubChem CID | 87462169 |
| Molecular Formula | C7H11N2O5+ |
| Molecular Weight | 203.17 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 1,3-dimethoxy-1-methyl-1,3-diazinan-1-ium-2,4,6-trione |
| SMILES | CON1C(=O)CC(=O)[N+](C)(OC)C1=O |
| InChI | InChI=1S/C7H11N2O5/c1-9(14-3)6(11)4-5(10)8(13-2)7(9)12/h4H2,1-3H3/q+1 |
| InChIKey | RSAGDFFTSBQZOV-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.17 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|