C23H13F6NO5S2 — CID 87462333
methyl 4-[7-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]sulfanyl]-2-oxochromen-4-yl]benzoate (PubChem CID 87462333) has the molecular formula C23H13F6NO5S2 and a molecular weight of 561.48 g/mol. Its IUPAC name is methyl 4-[7-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]sulfanyl]-2-oxochromen-4-yl]benzoate.
| Compound Name | methyl 4-[7-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]sulfanyl]-2-oxochromen-4-yl]benzoate |
|---|---|
| PubChem CID | 87462333 |
| Molecular Formula | C23H13F6NO5S2 |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 561.01 |
| IUPAC Name | methyl 4-[7-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]sulfanyl]-2-oxochromen-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(=O)oc3cc(Sc4ncc(C(O)(C(F)(F)F)C(F)(F)F)s4)ccc23)cc1 |
| InChI | InChI=1S/C23H13F6NO5S2/c1-34-19(32)12-4-2-11(3-5-12)15-9-18(31)35-16-8-13(6-7-14(15)16)36-20-30-10-17(37-20)21(33,22(24,25)26)23(27,28)29/h2-10,33H,1H3 |
| InChIKey | ZSMVILIBKRYFRK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|