C5H4F9N — CID 87462341
1,1,2,2,3,3,5,5,5-nonafluoropentan-1-amine (PubChem CID 87462341) has the molecular formula C5H4F9N and a molecular weight of 249.08 g/mol. Its IUPAC name is 1,1,2,2,3,3,5,5,5-nonafluoropentan-1-amine.
| Compound Name | 1,1,2,2,3,3,5,5,5-nonafluoropentan-1-amine |
|---|---|
| PubChem CID | 87462341 |
| Molecular Formula | C5H4F9N |
| Molecular Weight | 249.08 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 1,1,2,2,3,3,5,5,5-nonafluoropentan-1-amine |
| SMILES | NC(F)(F)C(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C5H4F9N/c6-2(7,1-3(8,9)10)4(11,12)5(13,14)15/h1,15H2 |
| InChIKey | FQSSTAXVDJSNSL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.08 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|