About 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one
7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one (PubChem CID 87462475) has the molecular formula C23H14FNO2S2
and a molecular weight of 419.50 g/mol. Its IUPAC name is 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one.
Molecular Properties
| Compound Name | 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one |
| PubChem CID | 87462475 |
| Molecular Formula | C23H14FNO2S2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one |
| SMILES | O=c1cc(-c2ccc(F)cc2)c2ccc(Sc3ncc(C4=CC=CC4)s3)cc2o1 |
| InChI | InChI=1S/C23H14FNO2S2/c24-16-7-5-14(6-8-16)19-12-22(26)27-20-11-17(9-10-18(19)20)28-23-25-13-21(29-23)15-3-1-2-4-15/h1-3,5-13H,4H2 |
| InChIKey | BZVMALOHBOLOCC-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one?
The IUPAC name of 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one (CID 87462475) is 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one.
What is the SMILES notation for 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one?
The canonical SMILES for 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one is O=c1cc(-c2ccc(F)cc2)c2ccc(Sc3ncc(C4=CC=CC4)s3)cc2o1.
What is the InChIKey of 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one?
The InChIKey is BZVMALOHBOLOCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14FNO2S2/c24-16-7-5-14(6-8-16)19-12-22(26)27-20-11-17(9-10-18(19)20)28-23-25-13-21(29-23)15-3-1-2-4-15/h1-3,5-13H,4H2.
What are the key properties of 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one?
7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one has a molecular weight of 419.50 g/mol, XLogP of 6.55, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(5-cyclopenta-1,3-dien-1-yl-1,3-thiazol-2-yl)sulfanyl]-4-(4-fluorophenyl)chromen-2-one is sourced from PubChem (CID 87462475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).