C10H16N2O2 — CID 87462651
N-methoxy-N-methyl-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxamide (PubChem CID 87462651) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is N-methoxy-N-methyl-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxamide.
| Compound Name | N-methoxy-N-methyl-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 87462651 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | N-methoxy-N-methyl-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxamide |
| SMILES | CON(C)C(=O)C1=CC2CNCC2C1 |
| InChI | InChI=1S/C10H16N2O2/c1-12(14-2)10(13)7-3-8-5-11-6-9(8)4-7/h3,8-9,11H,4-6H2,1-2H3 |
| InChIKey | KGEJSNYLZUNEKU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|