C17H19NO7 — CID 87462783
2-[1-(2,5-dihydroxyphenyl)ethylamino]-3-(2,3,4-trihydroxyphenyl)propanoic acid (PubChem CID 87462783) has the molecular formula C17H19NO7 and a molecular weight of 349.34 g/mol. Its IUPAC name is 2-[1-(2,5-dihydroxyphenyl)ethylamino]-3-(2,3,4-trihydroxyphenyl)propanoic acid.
| Compound Name | 2-[1-(2,5-dihydroxyphenyl)ethylamino]-3-(2,3,4-trihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 87462783 |
| Molecular Formula | C17H19NO7 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-[1-(2,5-dihydroxyphenyl)ethylamino]-3-(2,3,4-trihydroxyphenyl)propanoic acid |
| SMILES | CC(NC(Cc1ccc(O)c(O)c1O)C(=O)O)c1cc(O)ccc1O |
| InChI | InChI=1S/C17H19NO7/c1-8(11-7-10(19)3-5-13(11)20)18-12(17(24)25)6-9-2-4-14(21)16(23)15(9)22/h2-5,7-8,12,18-23H,6H2,1H3,(H,24,25) |
| InChIKey | DCILRPMXHHHSJJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|