C16H11F8NO4S4 — CID 87462835
1,1,2,2-tetrafluoro-2-phenylsulfanyl-N-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)sulfonylethanesulfonamide (PubChem CID 87462835) has the molecular formula C16H11F8NO4S4 and a molecular weight of 561.52 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-phenylsulfanyl-N-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)sulfonylethanesulfonamide.
| Compound Name | 1,1,2,2-tetrafluoro-2-phenylsulfanyl-N-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)sulfonylethanesulfonamide |
|---|---|
| PubChem CID | 87462835 |
| Molecular Formula | C16H11F8NO4S4 |
| Molecular Weight | 561.52 g/mol |
| Exact Mass | 560.94 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-phenylsulfanyl-N-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)sulfonylethanesulfonamide |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)C(F)(F)Sc1ccccc1)C(F)(F)C(F)(F)Sc1ccccc1 |
| InChI | InChI=1S/C16H11F8NO4S4/c17-13(18,30-11-7-3-1-4-8-11)15(21,22)32(26,27)25-33(28,29)16(23,24)14(19,20)31-12-9-5-2-6-10-12/h1-10,25H |
| InChIKey | OGRDMXJVDMWUQO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|