methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate

C16H13NO2S — CID 874637

IUPACmethyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate
SMILESCOC(=O)c1c(C)c(-c2cccs2)nc2ccccc12
InChIInChI=1S/C16H13NO2S/c1-10-14(16(18)19-2)11-6-3-4-7-12(11)17-15(10)13-8-5-9-20-13/h3-9H,1-2H3
InChIKeyDBXNZAKXQDPRJX-UHFFFAOYSA-N
MW283.35 g/mol
LogP4.06
Rot. Bonds2

About methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate

methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 874637) has the molecular formula C16H13NO2S and a molecular weight of 283.35 g/mol. Its IUPAC name is methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate.

Molecular Properties

Compound Namemethyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate
PubChem CID874637
Molecular FormulaC16H13NO2S
Molecular Weight283.35 g/mol
Exact Mass283.07
IUPAC Namemethyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate
SMILESCOC(=O)c1c(C)c(-c2cccs2)nc2ccccc12
InChIInChI=1S/C16H13NO2S/c1-10-14(16(18)19-2)11-6-3-4-7-12(11)17-15(10)13-8-5-9-20-13/h3-9H,1-2H3
InChIKeyDBXNZAKXQDPRJX-UHFFFAOYSA-N
XLogP4.06
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.35
LogP ≤ 54.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate?
The IUPAC name of methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate (CID 874637) is methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate.
What is the SMILES notation for methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate?
The canonical SMILES for methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate is COC(=O)c1c(C)c(-c2cccs2)nc2ccccc12.
What is the InChIKey of methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate?
The InChIKey is DBXNZAKXQDPRJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2S/c1-10-14(16(18)19-2)11-6-3-4-7-12(11)17-15(10)13-8-5-9-20-13/h3-9H,1-2H3.
What are the key properties of methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate?
methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate has a molecular weight of 283.35 g/mol, XLogP of 4.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyl-2-thiophen-2-ylquinoline-4-carboxylate is sourced from PubChem (CID 874637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).