C14H21F5N2O4S3 — CID 87463947
N,N-diethylethanamine;1,1-difluoro-N-[2-(trifluoromethylsulfonyl)phenyl]sulfanylmethanesulfonamide (PubChem CID 87463947) has the molecular formula C14H21F5N2O4S3 and a molecular weight of 472.52 g/mol. Its IUPAC name is N,N-diethylethanamine;1,1-difluoro-N-[2-(trifluoromethylsulfonyl)phenyl]sulfanylmethanesulfonamide.
| Compound Name | N,N-diethylethanamine;1,1-difluoro-N-[2-(trifluoromethylsulfonyl)phenyl]sulfanylmethanesulfonamide |
|---|---|
| PubChem CID | 87463947 |
| Molecular Formula | C14H21F5N2O4S3 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | N,N-diethylethanamine;1,1-difluoro-N-[2-(trifluoromethylsulfonyl)phenyl]sulfanylmethanesulfonamide |
| SMILES | CCN(CC)CC.O=S(=O)(NSc1ccccc1S(=O)(=O)C(F)(F)F)C(F)F |
| InChI | InChI=1S/C8H6F5NO4S3.C6H15N/c9-7(10)21(17,18)14-19-5-3-1-2-4-6(5)20(15,16)8(11,12)13;1-4-7(5-2)6-3/h1-4,7,14H;4-6H2,1-3H3 |
| InChIKey | QYWHSEKUDJJOAT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|