C23H21F5N2O2S2 — CID 87464192
4-[(3,5-dimethylphenyl)methyl]-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole (PubChem CID 87464192) has the molecular formula C23H21F5N2O2S2 and a molecular weight of 516.56 g/mol. Its IUPAC name is 4-[(3,5-dimethylphenyl)methyl]-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole.
| Compound Name | 4-[(3,5-dimethylphenyl)methyl]-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 87464192 |
| Molecular Formula | C23H21F5N2O2S2 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 4-[(3,5-dimethylphenyl)methyl]-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole |
| SMILES | Cc1cc(C)cc(Cc2csc(N3CCC(S(=O)(=O)c4c(F)c(F)c(F)c(F)c4F)CC3)n2)c1 |
| InChI | InChI=1S/C23H21F5N2O2S2/c1-12-7-13(2)9-14(8-12)10-15-11-33-23(29-15)30-5-3-16(4-6-30)34(31,32)22-20(27)18(25)17(24)19(26)21(22)28/h7-9,11,16H,3-6,10H2,1-2H3 |
| InChIKey | DNINARYRJVPXLN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|