About butyl 2-pyridin-1-ium-1-ylethyl sulfate
butyl 2-pyridin-1-ium-1-ylethyl sulfate (PubChem CID 87464258) has the molecular formula C11H18NO4S+
and a molecular weight of 260.33 g/mol. Its IUPAC name is butyl 2-pyridin-1-ium-1-ylethyl sulfate.
Molecular Properties
| Compound Name | butyl 2-pyridin-1-ium-1-ylethyl sulfate |
| PubChem CID | 87464258 |
| Molecular Formula | C11H18NO4S+ |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | butyl 2-pyridin-1-ium-1-ylethyl sulfate |
| SMILES | CCCCOS(=O)(=O)OCC[n+]1ccccc1 |
| InChI | InChI=1S/C11H18NO4S/c1-2-3-10-15-17(13,14)16-11-9-12-7-5-4-6-8-12/h4-8H,2-3,9-11H2,1H3/q+1 |
| InChIKey | KOYCVHCELTZOAD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-pyridin-1-ium-1-ylethyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-pyridin-1-ium-1-ylethyl sulfate?
The IUPAC name of butyl 2-pyridin-1-ium-1-ylethyl sulfate (CID 87464258) is butyl 2-pyridin-1-ium-1-ylethyl sulfate.
What is the SMILES notation for butyl 2-pyridin-1-ium-1-ylethyl sulfate?
The canonical SMILES for butyl 2-pyridin-1-ium-1-ylethyl sulfate is CCCCOS(=O)(=O)OCC[n+]1ccccc1.
What is the InChIKey of butyl 2-pyridin-1-ium-1-ylethyl sulfate?
The InChIKey is KOYCVHCELTZOAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18NO4S/c1-2-3-10-15-17(13,14)16-11-9-12-7-5-4-6-8-12/h4-8H,2-3,9-11H2,1H3/q+1.
What are the key properties of butyl 2-pyridin-1-ium-1-ylethyl sulfate?
butyl 2-pyridin-1-ium-1-ylethyl sulfate has a molecular weight of 260.33 g/mol, XLogP of 1.05, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-pyridin-1-ium-1-ylethyl sulfate is sourced from PubChem (CID 87464258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).