C27H29F12NOSi — CID 87464590
[(2R)-2,3-bis[3,5-bis(trifluoromethyl)phenyl]-1-methylpyrrolidin-2-yl]oxy-triethylsilane (PubChem CID 87464590) has the molecular formula C27H29F12NOSi and a molecular weight of 639.60 g/mol. Its IUPAC name is [(2R)-2,3-bis[3,5-bis(trifluoromethyl)phenyl]-1-methylpyrrolidin-2-yl]oxy-triethylsilane.
| Compound Name | [(2R)-2,3-bis[3,5-bis(trifluoromethyl)phenyl]-1-methylpyrrolidin-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 87464590 |
| Molecular Formula | C27H29F12NOSi |
| Molecular Weight | 639.60 g/mol |
| Exact Mass | 639.18 |
| IUPAC Name | [(2R)-2,3-bis[3,5-bis(trifluoromethyl)phenyl]-1-methylpyrrolidin-2-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@]1(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCN1C |
| InChI | InChI=1S/C27H29F12NOSi/c1-5-42(6-2,7-3)41-23(17-12-20(26(34,35)36)15-21(13-17)27(37,38)39)22(8-9-40(23)4)16-10-18(24(28,29)30)14-19(11-16)25(31,32)33/h10-15,22H,5-9H2,1-4H3/t22?,23-/m0/s1 |
| InChIKey | AKHKOVFBXASIIO-WCSIJFPASA-N |
| XLogP | 10.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.60 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|