C44H68P2 — CID 87464843
[3-[4,5-bis(4-tert-butylphenyl)-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane (PubChem CID 87464843) has the molecular formula C44H68P2 and a molecular weight of 658.98 g/mol. Its IUPAC name is [3-[4,5-bis(4-tert-butylphenyl)-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane.
| Compound Name | [3-[4,5-bis(4-tert-butylphenyl)-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane |
|---|---|
| PubChem CID | 87464843 |
| Molecular Formula | C44H68P2 |
| Molecular Weight | 658.98 g/mol |
| Exact Mass | 658.48 |
| IUPAC Name | [3-[4,5-bis(4-tert-butylphenyl)-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane |
| SMILES | CC(C)(C)c1ccc(-c2cc(C(P)(C(C)(C)C)C(C)(C)C)c(C(P)(C(C)(C)C)C(C)(C)C)cc2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C44H68P2/c1-37(2,3)31-23-19-29(20-24-31)33-27-35(43(45,39(7,8)9)40(10,11)12)36(44(46,41(13,14)15)42(16,17)18)28-34(33)30-21-25-32(26-22-30)38(4,5)6/h19-28H,45-46H2,1-18H3 |
| InChIKey | GTGBJQCMKMXTQN-UHFFFAOYSA-N |
| XLogP | 13.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.98 |
| LogP ≤ 5 | 13.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|