C20H16Br3F2N3O2S2 — CID 87465080
4-[(3-bromophenyl)methyl]-2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperazin-1-yl]-1,3-thiazole (PubChem CID 87465080) has the molecular formula C20H16Br3F2N3O2S2 and a molecular weight of 672.21 g/mol. Its IUPAC name is 4-[(3-bromophenyl)methyl]-2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperazin-1-yl]-1,3-thiazole.
| Compound Name | 4-[(3-bromophenyl)methyl]-2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 87465080 |
| Molecular Formula | C20H16Br3F2N3O2S2 |
| Molecular Weight | 672.21 g/mol |
| Exact Mass | 668.82 |
| IUPAC Name | 4-[(3-bromophenyl)methyl]-2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperazin-1-yl]-1,3-thiazole |
| SMILES | O=S(=O)(c1c(F)c(Br)cc(F)c1Br)N1CCN(c2nc(Cc3cccc(Br)c3)cs2)CC1 |
| InChI | InChI=1S/C20H16Br3F2N3O2S2/c21-13-3-1-2-12(8-13)9-14-11-31-20(26-14)27-4-6-28(7-5-27)32(29,30)19-17(23)16(24)10-15(22)18(19)25/h1-3,8,10-11H,4-7,9H2 |
| InChIKey | FYLRUUOKRVICQK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.21 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|