About 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde
2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde (PubChem CID 87465534) has the molecular formula C12H20O2S
and a molecular weight of 228.36 g/mol. Its IUPAC name is 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde |
| PubChem CID | 87465534 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde |
| SMILES | O=CCC1(C2CCCCC2)COCCS1 |
| InChI | InChI=1S/C12H20O2S/c13-7-6-12(10-14-8-9-15-12)11-4-2-1-3-5-11/h7,11H,1-6,8-10H2 |
| InChIKey | WBVLYRGZWXVWMB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde?
The IUPAC name of 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde (CID 87465534) is 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde.
What is the SMILES notation for 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde?
The canonical SMILES for 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde is O=CCC1(C2CCCCC2)COCCS1.
What is the InChIKey of 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde?
The InChIKey is WBVLYRGZWXVWMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2S/c13-7-6-12(10-14-8-9-15-12)11-4-2-1-3-5-11/h7,11H,1-6,8-10H2.
What are the key properties of 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde?
2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde has a molecular weight of 228.36 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclohexyl-1,4-oxathian-3-yl)acetaldehyde is sourced from PubChem (CID 87465534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).