C21H16Br2F4N2O2S2 — CID 87465573
2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(3,4-difluorophenyl)methyl]-1,3-thiazole (PubChem CID 87465573) has the molecular formula C21H16Br2F4N2O2S2 and a molecular weight of 628.31 g/mol. Its IUPAC name is 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(3,4-difluorophenyl)methyl]-1,3-thiazole.
| Compound Name | 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(3,4-difluorophenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 87465573 |
| Molecular Formula | C21H16Br2F4N2O2S2 |
| Molecular Weight | 628.31 g/mol |
| Exact Mass | 625.90 |
| IUPAC Name | 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(3,4-difluorophenyl)methyl]-1,3-thiazole |
| SMILES | O=S(=O)(c1c(F)c(Br)cc(F)c1Br)C1CCN(c2nc(Cc3ccc(F)c(F)c3)cs2)CC1 |
| InChI | InChI=1S/C21H16Br2F4N2O2S2/c22-14-9-17(26)18(23)20(19(14)27)33(30,31)13-3-5-29(6-4-13)21-28-12(10-32-21)7-11-1-2-15(24)16(25)8-11/h1-2,8-10,13H,3-7H2 |
| InChIKey | WUDUGSXOEZSJNL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.31 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|