C22H20Br2F2N2O3S2 — CID 87465725
2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(2-methoxyphenyl)methyl]-1,3-thiazole (PubChem CID 87465725) has the molecular formula C22H20Br2F2N2O3S2 and a molecular weight of 622.35 g/mol. Its IUPAC name is 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(2-methoxyphenyl)methyl]-1,3-thiazole.
| Compound Name | 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(2-methoxyphenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 87465725 |
| Molecular Formula | C22H20Br2F2N2O3S2 |
| Molecular Weight | 622.35 g/mol |
| Exact Mass | 619.93 |
| IUPAC Name | 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(2-methoxyphenyl)methyl]-1,3-thiazole |
| SMILES | COc1ccccc1Cc1csc(N2CCC(S(=O)(=O)c3c(F)c(Br)cc(F)c3Br)CC2)n1 |
| InChI | InChI=1S/C22H20Br2F2N2O3S2/c1-31-18-5-3-2-4-13(18)10-14-12-32-22(27-14)28-8-6-15(7-9-28)33(29,30)21-19(24)17(25)11-16(23)20(21)26/h2-5,11-12,15H,6-10H2,1H3 |
| InChIKey | MIQIMZNVKKFPGG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.35 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|