N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid

C9H24N2O8P2 — CID 87466351

IUPACN,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid
SMILESC=CCNCCCNCC=C.O=P(O)(O)O.O=P(O)(O)O
InChIInChI=1S/C9H18N2.2H3O4P/c1-3-6-10-8-5-9-11-7-4-2;2*1-5(2,3)4/h3-4,10-11H,1-2,5-9H2;2*(H3,1,2,3,4)
InChIKeyWDCVWTHSMNWZNY-UHFFFAOYSA-N
MW350.25 g/mol
LogP-0.93
Rot. Bonds8

About N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid

N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid (PubChem CID 87466351) has the molecular formula C9H24N2O8P2 and a molecular weight of 350.25 g/mol. Its IUPAC name is N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid.

Molecular Properties

Compound NameN,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid
PubChem CID87466351
Molecular FormulaC9H24N2O8P2
Molecular Weight350.25 g/mol
Exact Mass350.10
IUPAC NameN,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid
SMILESC=CCNCCCNCC=C.O=P(O)(O)O.O=P(O)(O)O
InChIInChI=1S/C9H18N2.2H3O4P/c1-3-6-10-8-5-9-11-7-4-2;2*1-5(2,3)4/h3-4,10-11H,1-2,5-9H2;2*(H3,1,2,3,4)
InChIKeyWDCVWTHSMNWZNY-UHFFFAOYSA-N
XLogP-0.93
TPSA179.58 Ų
H-Bond Donors8
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms21
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500350.25
LogP ≤ 5-0.93
H-Bond Donors ≤ 58
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid?
The IUPAC name of N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid (CID 87466351) is N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid.
What is the SMILES notation for N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid?
The canonical SMILES for N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid is C=CCNCCCNCC=C.O=P(O)(O)O.O=P(O)(O)O.
What is the InChIKey of N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid?
The InChIKey is WDCVWTHSMNWZNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2.2H3O4P/c1-3-6-10-8-5-9-11-7-4-2;2*1-5(2,3)4/h3-4,10-11H,1-2,5-9H2;2*(H3,1,2,3,4).
What are the key properties of N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid?
N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid has a molecular weight of 350.25 g/mol, XLogP of -0.93, 8 rotatable bonds, 8 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid is sourced from PubChem (CID 87466351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).