C21H15ClF6N2O2S2 — CID 87466398
4-[(3-chloro-5-fluorophenyl)methyl]-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole (PubChem CID 87466398) has the molecular formula C21H15ClF6N2O2S2 and a molecular weight of 540.94 g/mol. Its IUPAC name is 4-[(3-chloro-5-fluorophenyl)methyl]-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole.
| Compound Name | 4-[(3-chloro-5-fluorophenyl)methyl]-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 87466398 |
| Molecular Formula | C21H15ClF6N2O2S2 |
| Molecular Weight | 540.94 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | 4-[(3-chloro-5-fluorophenyl)methyl]-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole |
| SMILES | O=S(=O)(c1c(F)c(F)c(F)c(F)c1F)C1CCN(c2nc(Cc3cc(F)cc(Cl)c3)cs2)CC1 |
| InChI | InChI=1S/C21H15ClF6N2O2S2/c22-11-5-10(6-12(23)8-11)7-13-9-33-21(29-13)30-3-1-14(2-4-30)34(31,32)20-18(27)16(25)15(24)17(26)19(20)28/h5-6,8-9,14H,1-4,7H2 |
| InChIKey | SODZYCGXHONXCS-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.94 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|