C13H25NO4 — CID 87466441
(4R)-N-methoxy-N,2,2,5,5-pentamethyl-4-propan-2-yl-1,3-dioxolane-4-carboxamide (PubChem CID 87466441) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is (4R)-N-methoxy-N,2,2,5,5-pentamethyl-4-propan-2-yl-1,3-dioxolane-4-carboxamide.
| Compound Name | (4R)-N-methoxy-N,2,2,5,5-pentamethyl-4-propan-2-yl-1,3-dioxolane-4-carboxamide |
|---|---|
| PubChem CID | 87466441 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | (4R)-N-methoxy-N,2,2,5,5-pentamethyl-4-propan-2-yl-1,3-dioxolane-4-carboxamide |
| SMILES | CON(C)C(=O)[C@]1(C(C)C)OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H25NO4/c1-9(2)13(10(15)14(7)16-8)11(3,4)17-12(5,6)18-13/h9H,1-8H3/t13-/m0/s1 |
| InChIKey | KPXQZLBEESZAQE-ZDUSSCGKSA-N |
| XLogP | 1.96 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|