C23H22Br2F2N2O5S2 — CID 87466584
2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-(3,4,5-trimethoxyphenyl)-1,3-thiazole (PubChem CID 87466584) has the molecular formula C23H22Br2F2N2O5S2 and a molecular weight of 668.38 g/mol. Its IUPAC name is 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-(3,4,5-trimethoxyphenyl)-1,3-thiazole.
| Compound Name | 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-(3,4,5-trimethoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 87466584 |
| Molecular Formula | C23H22Br2F2N2O5S2 |
| Molecular Weight | 668.38 g/mol |
| Exact Mass | 665.93 |
| IUPAC Name | 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-(3,4,5-trimethoxyphenyl)-1,3-thiazole |
| SMILES | COc1cc(-c2csc(N3CCC(S(=O)(=O)c4c(F)c(Br)cc(F)c4Br)CC3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H22Br2F2N2O5S2/c1-32-17-8-12(9-18(33-2)21(17)34-3)16-11-35-23(28-16)29-6-4-13(5-7-29)36(30,31)22-19(25)15(26)10-14(24)20(22)27/h8-11,13H,4-7H2,1-3H3 |
| InChIKey | LZKMHXGWVWNYOA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.38 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|