C23H22Br2F2N2O2S2 — CID 87466645
2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(2,5-dimethylphenyl)methyl]-1,3-thiazole (PubChem CID 87466645) has the molecular formula C23H22Br2F2N2O2S2 and a molecular weight of 620.38 g/mol. Its IUPAC name is 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(2,5-dimethylphenyl)methyl]-1,3-thiazole.
| Compound Name | 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(2,5-dimethylphenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 87466645 |
| Molecular Formula | C23H22Br2F2N2O2S2 |
| Molecular Weight | 620.38 g/mol |
| Exact Mass | 617.95 |
| IUPAC Name | 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(2,5-dimethylphenyl)methyl]-1,3-thiazole |
| SMILES | Cc1ccc(C)c(Cc2csc(N3CCC(S(=O)(=O)c4c(F)c(Br)cc(F)c4Br)CC3)n2)c1 |
| InChI | InChI=1S/C23H22Br2F2N2O2S2/c1-13-3-4-14(2)15(9-13)10-16-12-32-23(28-16)29-7-5-17(6-8-29)33(30,31)22-20(25)19(26)11-18(24)21(22)27/h3-4,9,11-12,17H,5-8,10H2,1-2H3 |
| InChIKey | QRXXFWOAVRFZGV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.38 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|