C26H25F6NO5S3 — CID 87466656
(triphenyl-λ4-sulfanyl) 1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropane-1-sulfonate (PubChem CID 87466656) has the molecular formula C26H25F6NO5S3 and a molecular weight of 641.68 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropane-1-sulfonate.
| Compound Name | (triphenyl-λ4-sulfanyl) 1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropane-1-sulfonate |
|---|---|
| PubChem CID | 87466656 |
| Molecular Formula | C26H25F6NO5S3 |
| Molecular Weight | 641.68 g/mol |
| Exact Mass | 641.08 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropane-1-sulfonate |
| SMILES | O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C26H25F6NO5S3/c27-24(28,25(29,30)40(34,35)33-19-11-4-12-20-33)26(31,32)41(36,37)38-39(21-13-5-1-6-14-21,22-15-7-2-8-16-22)23-17-9-3-10-18-23/h1-3,5-10,13-18H,4,11-12,19-20H2 |
| InChIKey | WYLWHJVUCZOSGA-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.68 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|