C20H14Br2F4N2O2S2 — CID 87466732
2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-(3,4-difluorophenyl)-1,3-thiazole (PubChem CID 87466732) has the molecular formula C20H14Br2F4N2O2S2 and a molecular weight of 614.28 g/mol. Its IUPAC name is 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-(3,4-difluorophenyl)-1,3-thiazole.
| Compound Name | 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-(3,4-difluorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 87466732 |
| Molecular Formula | C20H14Br2F4N2O2S2 |
| Molecular Weight | 614.28 g/mol |
| Exact Mass | 611.88 |
| IUPAC Name | 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-(3,4-difluorophenyl)-1,3-thiazole |
| SMILES | O=S(=O)(c1c(F)c(Br)cc(F)c1Br)C1CCN(c2nc(-c3ccc(F)c(F)c3)cs2)CC1 |
| InChI | InChI=1S/C20H14Br2F4N2O2S2/c21-12-8-15(25)17(22)19(18(12)26)32(29,30)11-3-5-28(6-4-11)20-27-16(9-31-20)10-1-2-13(23)14(24)7-10/h1-2,7-9,11H,3-6H2 |
| InChIKey | XCNJRKOYCBHMLW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.28 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|