C24H24Br2F2N2O5S2 — CID 87466831
2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(3,4,5-trimethoxyphenyl)methyl]-1,3-thiazole (PubChem CID 87466831) has the molecular formula C24H24Br2F2N2O5S2 and a molecular weight of 682.40 g/mol. Its IUPAC name is 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(3,4,5-trimethoxyphenyl)methyl]-1,3-thiazole.
| Compound Name | 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(3,4,5-trimethoxyphenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 87466831 |
| Molecular Formula | C24H24Br2F2N2O5S2 |
| Molecular Weight | 682.40 g/mol |
| Exact Mass | 679.95 |
| IUPAC Name | 2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-4-[(3,4,5-trimethoxyphenyl)methyl]-1,3-thiazole |
| SMILES | COc1cc(Cc2csc(N3CCC(S(=O)(=O)c4c(F)c(Br)cc(F)c4Br)CC3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C24H24Br2F2N2O5S2/c1-33-18-9-13(10-19(34-2)22(18)35-3)8-14-12-36-24(29-14)30-6-4-15(5-7-30)37(31,32)23-20(26)17(27)11-16(25)21(23)28/h9-12,15H,4-8H2,1-3H3 |
| InChIKey | LKVOXDVFEDJPRR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.40 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|