About propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate
propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate (PubChem CID 874670) has the molecular formula C16H19NO4S
and a molecular weight of 321.40 g/mol. Its IUPAC name is propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
| PubChem CID | 874670 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
| SMILES | COc1ccc(-c2csc(N)c2C(=O)OC(C)C)cc1OC |
| InChI | InChI=1S/C16H19NO4S/c1-9(2)21-16(18)14-11(8-22-15(14)17)10-5-6-12(19-3)13(7-10)20-4/h5-9H,17H2,1-4H3 |
| InChIKey | WEHPOCNINSGWET-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate?
The IUPAC name of propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate (CID 874670) is propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate.
What is the SMILES notation for propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate?
The canonical SMILES for propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate is COc1ccc(-c2csc(N)c2C(=O)OC(C)C)cc1OC.
What is the InChIKey of propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate?
The InChIKey is WEHPOCNINSGWET-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4S/c1-9(2)21-16(18)14-11(8-22-15(14)17)10-5-6-12(19-3)13(7-10)20-4/h5-9H,17H2,1-4H3.
What are the key properties of propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate?
propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate has a molecular weight of 321.40 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-amino-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate is sourced from PubChem (CID 874670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).