C10H24N2O7P2 — CID 87467213
N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphono dihydrogen phosphate (PubChem CID 87467213) has the molecular formula C10H24N2O7P2 and a molecular weight of 346.26 g/mol. Its IUPAC name is N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphono dihydrogen phosphate.
| Compound Name | N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 87467213 |
| Molecular Formula | C10H24N2O7P2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphono dihydrogen phosphate |
| SMILES | C=CCNCCCCNCC=C.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H20N2.H4O7P2/c1-3-7-11-9-5-6-10-12-8-4-2;1-8(2,3)7-9(4,5)6/h3-4,11-12H,1-2,5-10H2;(H2,1,2,3)(H2,4,5,6) |
| InChIKey | USOBFKHDFDOJFR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|