C32BF24- — CID 87467756
bis(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-bis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 87467756) has the molecular formula C32BF24- and a molecular weight of 851.12 g/mol. Its IUPAC name is bis(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-bis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | bis(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 87467756 |
| Molecular Formula | C32BF24- |
| Molecular Weight | 851.12 g/mol |
| Exact Mass | 850.97 |
| IUPAC Name | bis(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c3c(F)c(F)c(F)c(F)c23)c2c(F)c(F)c(F)c3c(F)c(F)c(F)c(F)c23)c(F)c1F |
| InChI | InChI=1S/C32BF24/c34-9-1-3(13(38)25(50)23(9)48)11(36)21(46)15(40)5(1)33(7-17(42)27(52)31(56)28(53)18(7)43,8-19(44)29(54)32(57)30(55)20(8)45)6-2-4(12(37)22(47)16(6)41)14(39)26(51)24(49)10(2)35/q-1 |
| InChIKey | RESRKGMKVIMHAH-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.12 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|