About 2-methylpropanethioamide;hydrochloride
2-methylpropanethioamide;hydrochloride (PubChem CID 87468880) has the molecular formula C4H10ClNS
and a molecular weight of 139.65 g/mol. Its IUPAC name is 2-methylpropanethioamide;hydrochloride.
Molecular Properties
| Compound Name | 2-methylpropanethioamide;hydrochloride |
| PubChem CID | 87468880 |
| Molecular Formula | C4H10ClNS |
| Molecular Weight | 139.65 g/mol |
| Exact Mass | 139.02 |
| IUPAC Name | 2-methylpropanethioamide;hydrochloride |
| SMILES | CC(C)C(N)=S.Cl |
| InChI | InChI=1S/C4H9NS.ClH/c1-3(2)4(5)6;/h3H,1-2H3,(H2,5,6);1H |
| InChIKey | ZUURTFDLYSRYHS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.65 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanethioamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanethioamide;hydrochloride?
The IUPAC name of 2-methylpropanethioamide;hydrochloride (CID 87468880) is 2-methylpropanethioamide;hydrochloride.
What is the SMILES notation for 2-methylpropanethioamide;hydrochloride?
The canonical SMILES for 2-methylpropanethioamide;hydrochloride is CC(C)C(N)=S.Cl.
What is the InChIKey of 2-methylpropanethioamide;hydrochloride?
The InChIKey is ZUURTFDLYSRYHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NS.ClH/c1-3(2)4(5)6;/h3H,1-2H3,(H2,5,6);1H.
What are the key properties of 2-methylpropanethioamide;hydrochloride?
2-methylpropanethioamide;hydrochloride has a molecular weight of 139.65 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanethioamide;hydrochloride is sourced from PubChem (CID 87468880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).