C25H31F6N3O5S — CID 87468917
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2-methylpropyl)-1-[2-oxo-1-(2-sulfonylmorpholin-4-yl)ethyl]piperidine-4-carboxamide (PubChem CID 87468917) has the molecular formula C25H31F6N3O5S and a molecular weight of 599.59 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2-methylpropyl)-1-[2-oxo-1-(2-sulfonylmorpholin-4-yl)ethyl]piperidine-4-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2-methylpropyl)-1-[2-oxo-1-(2-sulfonylmorpholin-4-yl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 87468917 |
| Molecular Formula | C25H31F6N3O5S |
| Molecular Weight | 599.59 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2-methylpropyl)-1-[2-oxo-1-(2-sulfonylmorpholin-4-yl)ethyl]piperidine-4-carboxamide |
| SMILES | CC(C)CC1(C(=O)NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCN(C(C=O)N2CCOC(=S(=O)=O)C2)CC1 |
| InChI | InChI=1S/C25H31F6N3O5S/c1-16(2)12-23(3-5-33(6-4-23)20(15-35)34-7-8-39-21(14-34)40(37)38)22(36)32-13-17-9-18(24(26,27)28)11-19(10-17)25(29,30)31/h9-11,15-16,20H,3-8,12-14H2,1-2H3,(H,32,36) |
| InChIKey | GPSLBXKIXQYGTP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|