About 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine
1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine (PubChem CID 87469086) has the molecular formula C6H9FN2S
and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine.
Molecular Properties
| Compound Name | 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine |
| PubChem CID | 87469086 |
| Molecular Formula | C6H9FN2S |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine |
| SMILES | Cc1cc(NNF)sc1C |
| InChI | InChI=1S/C6H9FN2S/c1-4-3-6(8-9-7)10-5(4)2/h3,8-9H,1-2H3 |
| InChIKey | UMEFFHPGHJRCCP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine?
The IUPAC name of 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine (CID 87469086) is 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine.
What is the SMILES notation for 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine?
The canonical SMILES for 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine is Cc1cc(NNF)sc1C.
What is the InChIKey of 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine?
The InChIKey is UMEFFHPGHJRCCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FN2S/c1-4-3-6(8-9-7)10-5(4)2/h3,8-9H,1-2H3.
What are the key properties of 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine?
1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine has a molecular weight of 160.22 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dimethylthiophen-2-yl)-2-fluorohydrazine is sourced from PubChem (CID 87469086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).