About cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate
cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate (PubChem CID 87469496) has the molecular formula C27H27F2NS3
and a molecular weight of 499.72 g/mol. Its IUPAC name is cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate.
Molecular Properties
| Compound Name | cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate |
| PubChem CID | 87469496 |
| Molecular Formula | C27H27F2NS3 |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate |
| SMILES | Fc1ccc(SC(C/C(=N/c2ccccc2)SCC2CCCC2)Sc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H27F2NS3/c28-21-10-14-24(15-11-21)32-27(33-25-16-12-22(29)13-17-25)18-26(30-23-8-2-1-3-9-23)31-19-20-6-4-5-7-20/h1-3,8-17,20,27H,4-7,18-19H2/b30-26- |
| InChIKey | BQFUZHRYLFGTJX-BXVZCJGGSA-N |
| XLogP | 9.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate?
The IUPAC name of cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate (CID 87469496) is cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate.
What is the SMILES notation for cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate?
The canonical SMILES for cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate is Fc1ccc(SC(C/C(=N/c2ccccc2)SCC2CCCC2)Sc2ccc(F)cc2)cc1.
What is the InChIKey of cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate?
The InChIKey is BQFUZHRYLFGTJX-BXVZCJGGSA-N. The full InChI is InChI=1S/C27H27F2NS3/c28-21-10-14-24(15-11-21)32-27(33-25-16-12-22(29)13-17-25)18-26(30-23-8-2-1-3-9-23)31-19-20-6-4-5-7-20/h1-3,8-17,20,27H,4-7,18-19H2/b30-26-.
What are the key properties of cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate?
cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate has a molecular weight of 499.72 g/mol, XLogP of 9.22, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylpropanimidothioate is sourced from PubChem (CID 87469496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).