About 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine
2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine (PubChem CID 87469783) has the molecular formula C31H40N2O3S
and a molecular weight of 520.74 g/mol. Its IUPAC name is 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine.
Molecular Properties
| Compound Name | 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine |
| PubChem CID | 87469783 |
| Molecular Formula | C31H40N2O3S |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine |
| SMILES | CCCCN(CCCC)c1cccc2ccccc12.CCCC[n+]1ccc2ccccc2c1S(=O)(=O)[O-] |
| InChI | InChI=1S/C18H25N.C13H15NO3S/c1-3-5-14-19(15-6-4-2)18-13-9-11-16-10-7-8-12-17(16)18;1-2-3-9-14-10-8-11-6-4-5-7-12(11)13(14)18(15,16)17/h7-13H,3-6,14-15H2,1-2H3;4-8,10H,2-3,9H2,1H3 |
| InChIKey | IPMNAZYQYVUYKW-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine?
The IUPAC name of 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine (CID 87469783) is 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine.
What is the SMILES notation for 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine?
The canonical SMILES for 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine is CCCCN(CCCC)c1cccc2ccccc12.CCCC[n+]1ccc2ccccc2c1S(=O)(=O)[O-].
What is the InChIKey of 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine?
The InChIKey is IPMNAZYQYVUYKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N.C13H15NO3S/c1-3-5-14-19(15-6-4-2)18-13-9-11-16-10-7-8-12-17(16)18;1-2-3-9-14-10-8-11-6-4-5-7-12(11)13(14)18(15,16)17/h7-13H,3-6,14-15H2,1-2H3;4-8,10H,2-3,9H2,1H3.
What are the key properties of 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine?
2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine has a molecular weight of 520.74 g/mol, XLogP of 7.08, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylisoquinolin-2-ium-1-sulfonate;N,N-dibutylnaphthalen-1-amine is sourced from PubChem (CID 87469783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).