C27H36O9 — CID 87469826
4,5,6-tris(4-ethenoxybutyl)benzene-1,2,3-tricarboxylic acid (PubChem CID 87469826) has the molecular formula C27H36O9 and a molecular weight of 504.58 g/mol. Its IUPAC name is 4,5,6-tris(4-ethenoxybutyl)benzene-1,2,3-tricarboxylic acid.
| Compound Name | 4,5,6-tris(4-ethenoxybutyl)benzene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87469826 |
| Molecular Formula | C27H36O9 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 4,5,6-tris(4-ethenoxybutyl)benzene-1,2,3-tricarboxylic acid |
| SMILES | C=COCCCCc1c(CCCCOC=C)c(C(=O)O)c(C(=O)O)c(C(=O)O)c1CCCCOC=C |
| InChI | InChI=1S/C27H36O9/c1-4-34-16-10-7-13-19-20(14-8-11-17-35-5-2)22(25(28)29)24(27(32)33)23(26(30)31)21(19)15-9-12-18-36-6-3/h4-6H,1-3,7-18H2,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | VEKHIARFAFLJCO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|