About 4-(4-propylphenyl)-1,3-thiazol-2-amine
4-(4-propylphenyl)-1,3-thiazol-2-amine (PubChem CID 874716) has the molecular formula C12H14N2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 4-(4-propylphenyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(4-propylphenyl)-1,3-thiazol-2-amine |
| PubChem CID | 874716 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-(4-propylphenyl)-1,3-thiazol-2-amine |
| SMILES | CCCc1ccc(-c2csc(N)n2)cc1 |
| InChI | InChI=1S/C12H14N2S/c1-2-3-9-4-6-10(7-5-9)11-8-15-12(13)14-11/h4-8H,2-3H2,1H3,(H2,13,14) |
| InChIKey | MWWKFIPFFAXPGN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-propylphenyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-propylphenyl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(4-propylphenyl)-1,3-thiazol-2-amine (CID 874716) is 4-(4-propylphenyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(4-propylphenyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(4-propylphenyl)-1,3-thiazol-2-amine is CCCc1ccc(-c2csc(N)n2)cc1.
What is the InChIKey of 4-(4-propylphenyl)-1,3-thiazol-2-amine?
The InChIKey is MWWKFIPFFAXPGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S/c1-2-3-9-4-6-10(7-5-9)11-8-15-12(13)14-11/h4-8H,2-3H2,1H3,(H2,13,14).
What are the key properties of 4-(4-propylphenyl)-1,3-thiazol-2-amine?
4-(4-propylphenyl)-1,3-thiazol-2-amine has a molecular weight of 218.32 g/mol, XLogP of 3.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-propylphenyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 874716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).