C25H27N3O4 — CID 87472157
4-[[2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetyl]amino]-N-phenylmethoxypentanamide (PubChem CID 87472157) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-[[2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetyl]amino]-N-phenylmethoxypentanamide.
| Compound Name | 4-[[2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetyl]amino]-N-phenylmethoxypentanamide |
|---|---|
| PubChem CID | 87472157 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 4-[[2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetyl]amino]-N-phenylmethoxypentanamide |
| SMILES | CC(CCC(=O)NOCc1ccccc1)NC(=O)C(=O)c1cn2c3c(cccc13)CCC2 |
| InChI | InChI=1S/C25H27N3O4/c1-17(12-13-22(29)27-32-16-18-7-3-2-4-8-18)26-25(31)24(30)21-15-28-14-6-10-19-9-5-11-20(21)23(19)28/h2-5,7-9,11,15,17H,6,10,12-14,16H2,1H3,(H,26,31)(H,27,29) |
| InChIKey | KSZIPNTZINRZCH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|