C23H19F2NO2S — CID 87473443
5-[2-(1-benzothiophen-2-yl)ethynyl]-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3,4-difluorobenzaldehyde (PubChem CID 87473443) has the molecular formula C23H19F2NO2S and a molecular weight of 411.47 g/mol. Its IUPAC name is 5-[2-(1-benzothiophen-2-yl)ethynyl]-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3,4-difluorobenzaldehyde.
| Compound Name | 5-[2-(1-benzothiophen-2-yl)ethynyl]-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3,4-difluorobenzaldehyde |
|---|---|
| PubChem CID | 87473443 |
| Molecular Formula | C23H19F2NO2S |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 5-[2-(1-benzothiophen-2-yl)ethynyl]-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3,4-difluorobenzaldehyde |
| SMILES | C[C@@H]1CN(c2c(C=O)cc(C#Cc3cc4ccccc4s3)c(F)c2F)C[C@H](C)O1 |
| InChI | InChI=1S/C23H19F2NO2S/c1-14-11-26(12-15(2)28-14)23-18(13-27)9-17(21(24)22(23)25)7-8-19-10-16-5-3-4-6-20(16)29-19/h3-6,9-10,13-15H,11-12H2,1-2H3/t14-,15+ |
| InChIKey | ZJRWXZRNWPROJZ-GASCZTMLSA-N |
| XLogP | 5.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|