C12H3F10NO4P2S2 — CID 87474092
bis[(2,3,4,5,6-pentafluorophenyl)sulfanyl]phosphinimyl dihydrogen phosphate (PubChem CID 87474092) has the molecular formula C12H3F10NO4P2S2 and a molecular weight of 541.22 g/mol. Its IUPAC name is bis[(2,3,4,5,6-pentafluorophenyl)sulfanyl]phosphinimyl dihydrogen phosphate.
| Compound Name | bis[(2,3,4,5,6-pentafluorophenyl)sulfanyl]phosphinimyl dihydrogen phosphate |
|---|---|
| PubChem CID | 87474092 |
| Molecular Formula | C12H3F10NO4P2S2 |
| Molecular Weight | 541.22 g/mol |
| Exact Mass | 540.88 |
| IUPAC Name | bis[(2,3,4,5,6-pentafluorophenyl)sulfanyl]phosphinimyl dihydrogen phosphate |
| SMILES | [H]N=P(OP(=O)(O)O)(Sc1c(F)c(F)c(F)c(F)c1F)Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H3F10NO4P2S2/c13-1-3(15)7(19)11(8(20)4(1)16)30-28(23,27-29(24,25)26)31-12-9(21)5(17)2(14)6(18)10(12)22/h23H,(H2,24,25,26) |
| InChIKey | VLMOIBOXZOMZLG-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 90.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.22 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|