About 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate
2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate (PubChem CID 87474183) has the molecular formula C14H24O6P2S2
and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate |
| PubChem CID | 87474183 |
| Molecular Formula | C14H24O6P2S2 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate |
| SMILES | O=P(O)(OC1CC2CCC1C2)OP(=O)(OC1CC2CCC1C2)SS |
| InChI | InChI=1S/C14H24O6P2S2/c15-21(16,18-13-7-9-1-3-11(13)5-9)20-22(17,24-23)19-14-8-10-2-4-12(14)6-10/h9-14,23H,1-8H2,(H,15,16) |
| InChIKey | IRKARXDSQMFAML-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate?
The IUPAC name of 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate (CID 87474183) is 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate.
What is the SMILES notation for 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate?
The canonical SMILES for 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate is O=P(O)(OC1CC2CCC1C2)OP(=O)(OC1CC2CCC1C2)SS.
What is the InChIKey of 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate?
The InChIKey is IRKARXDSQMFAML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O6P2S2/c15-21(16,18-13-7-9-1-3-11(13)5-9)20-22(17,24-23)19-14-8-10-2-4-12(14)6-10/h9-14,23H,1-8H2,(H,15,16).
What are the key properties of 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate?
2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate has a molecular weight of 414.42 g/mol, XLogP of 5.20, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]heptanyl [2-bicyclo[2.2.1]heptanyloxy(disulfanyl)phosphoryl] hydrogen phosphate is sourced from PubChem (CID 87474183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).