About 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one
1-sulfanyl-10,10a-dihydro-1H-acridin-2-one (PubChem CID 87475109) has the molecular formula C13H11NOS
and a molecular weight of 229.30 g/mol. Its IUPAC name is 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one.
Molecular Properties
| Compound Name | 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one |
| PubChem CID | 87475109 |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one |
| SMILES | O=C1C=CC2=C(C=C3C=CC=CC3N2)C1S |
| InChI | InChI=1S/C13H11NOS/c15-12-6-5-11-9(13(12)16)7-8-3-1-2-4-10(8)14-11/h1-7,10,13-14,16H |
| InChIKey | QEJCJPFXQGNUTQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one?
The IUPAC name of 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one (CID 87475109) is 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one.
What is the SMILES notation for 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one?
The canonical SMILES for 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one is O=C1C=CC2=C(C=C3C=CC=CC3N2)C1S.
What is the InChIKey of 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one?
The InChIKey is QEJCJPFXQGNUTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NOS/c15-12-6-5-11-9(13(12)16)7-8-3-1-2-4-10(8)14-11/h1-7,10,13-14,16H.
What are the key properties of 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one?
1-sulfanyl-10,10a-dihydro-1H-acridin-2-one has a molecular weight of 229.30 g/mol, XLogP of 1.70, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfanyl-10,10a-dihydro-1H-acridin-2-one is sourced from PubChem (CID 87475109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).