About 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione
1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione (PubChem CID 87475138) has the molecular formula C10H17NO2S2
and a molecular weight of 247.38 g/mol. Its IUPAC name is 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione |
| PubChem CID | 87475138 |
| Molecular Formula | C10H17NO2S2 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CCCCCC(S)S |
| InChI | InChI=1S/C10H17NO2S2/c12-8-5-6-9(13)11(8)7-3-1-2-4-10(14)15/h10,14-15H,1-7H2 |
| InChIKey | ODRJYFNNJNHHKT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione?
The IUPAC name of 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione (CID 87475138) is 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione.
What is the SMILES notation for 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione?
The canonical SMILES for 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione is O=C1CCC(=O)N1CCCCCC(S)S.
What is the InChIKey of 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione?
The InChIKey is ODRJYFNNJNHHKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2S2/c12-8-5-6-9(13)11(8)7-3-1-2-4-10(14)15/h10,14-15H,1-7H2.
What are the key properties of 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione?
1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione has a molecular weight of 247.38 g/mol, XLogP of 1.88, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6,6-bis(sulfanyl)hexyl]pyrrolidine-2,5-dione is sourced from PubChem (CID 87475138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).