C11H18S2 — CID 87475229
4,5,6,7,8,9,10,11-octahydro-3H-cyclodeca[c]dithiole (PubChem CID 87475229) has the molecular formula C11H18S2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 4,5,6,7,8,9,10,11-octahydro-3H-cyclodeca[c]dithiole.
| Compound Name | 4,5,6,7,8,9,10,11-octahydro-3H-cyclodeca[c]dithiole |
|---|---|
| PubChem CID | 87475229 |
| Molecular Formula | C11H18S2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 4,5,6,7,8,9,10,11-octahydro-3H-cyclodeca[c]dithiole |
| SMILES | C1CCCCC2=C(CCC1)CSS2 |
| InChI | InChI=1S/C11H18S2/c1-2-4-6-8-11-10(7-5-3-1)9-12-13-11/h1-9H2 |
| InChIKey | MXOROZCOWAWTKC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|