About 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea
1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea (PubChem CID 87475466) has the molecular formula C8H3F5N2OS
and a molecular weight of 270.18 g/mol. Its IUPAC name is 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea.
Molecular Properties
| Compound Name | 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea |
| PubChem CID | 87475466 |
| Molecular Formula | C8H3F5N2OS |
| Molecular Weight | 270.18 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea |
| SMILES | O=C(N(F)F)N(F)C(=S)c1cccc(F)c1F |
| InChI | InChI=1S/C8H3F5N2OS/c9-5-3-1-2-4(6(5)10)7(17)14(11)8(16)15(12)13/h1-3H |
| InChIKey | OCOXOODAULWIPX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.18 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea?
The IUPAC name of 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea (CID 87475466) is 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea.
What is the SMILES notation for 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea?
The canonical SMILES for 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea is O=C(N(F)F)N(F)C(=S)c1cccc(F)c1F.
What is the InChIKey of 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea?
The InChIKey is OCOXOODAULWIPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F5N2OS/c9-5-3-1-2-4(6(5)10)7(17)14(11)8(16)15(12)13/h1-3H.
What are the key properties of 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea?
1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea has a molecular weight of 270.18 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-difluorobenzenecarbothioyl)-1,3,3-trifluorourea is sourced from PubChem (CID 87475466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).