About 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide
2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide (PubChem CID 87475786) has the molecular formula C15H19N3O5
and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide.
Molecular Properties
| Compound Name | 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide |
| PubChem CID | 87475786 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide |
| SMILES | CC1CCCC(c2c(C(N)=O)cc([N+](=O)[O-])cc2[N+](=O)[O-])C1C |
| InChI | InChI=1S/C15H19N3O5/c1-8-4-3-5-11(9(8)2)14-12(15(16)19)6-10(17(20)21)7-13(14)18(22)23/h6-9,11H,3-5H2,1-2H3,(H2,16,19) |
| InChIKey | HTHLBFUPBAJFSJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide?
The IUPAC name of 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide (CID 87475786) is 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide.
What is the SMILES notation for 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide?
The canonical SMILES for 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide is CC1CCCC(c2c(C(N)=O)cc([N+](=O)[O-])cc2[N+](=O)[O-])C1C.
What is the InChIKey of 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide?
The InChIKey is HTHLBFUPBAJFSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O5/c1-8-4-3-5-11(9(8)2)14-12(15(16)19)6-10(17(20)21)7-13(14)18(22)23/h6-9,11H,3-5H2,1-2H3,(H2,16,19).
What are the key properties of 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide?
2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide has a molecular weight of 321.33 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylcyclohexyl)-3,5-dinitrobenzamide is sourced from PubChem (CID 87475786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).