C9H14S2 — CID 87476570
4,5,6,7,8,9-hexahydro-3H-cycloocta[c]dithiole (PubChem CID 87476570) has the molecular formula C9H14S2 and a molecular weight of 186.34 g/mol. Its IUPAC name is 4,5,6,7,8,9-hexahydro-3H-cycloocta[c]dithiole.
| Compound Name | 4,5,6,7,8,9-hexahydro-3H-cycloocta[c]dithiole |
|---|---|
| PubChem CID | 87476570 |
| Molecular Formula | C9H14S2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 4,5,6,7,8,9-hexahydro-3H-cycloocta[c]dithiole |
| SMILES | C1CCCC2=C(CC1)CSS2 |
| InChI | InChI=1S/C9H14S2/c1-2-4-6-9-8(5-3-1)7-10-11-9/h1-7H2 |
| InChIKey | AKXHZBPBXVJYDX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|